C26H33N2+ — CID 169055388
7-(3,3-dimethylcyclopentyl)-2,3-dimethyl-4-(2,3,5-trimethylphenyl)quinazolin-3-ium (PubChem CID 169055388) has the molecular formula C26H33N2+ and a molecular weight of 373.56 g/mol. Its IUPAC name is 7-(3,3-dimethylcyclopentyl)-2,3-dimethyl-4-(2,3,5-trimethylphenyl)quinazolin-3-ium.
| Compound Name | 7-(3,3-dimethylcyclopentyl)-2,3-dimethyl-4-(2,3,5-trimethylphenyl)quinazolin-3-ium |
|---|---|
| PubChem CID | 169055388 |
| Molecular Formula | C26H33N2+ |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 7-(3,3-dimethylcyclopentyl)-2,3-dimethyl-4-(2,3,5-trimethylphenyl)quinazolin-3-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3ccc(C4CCC(C)(C)C4)cc3nc(C)[n+]2C)c1 |
| InChI | InChI=1S/C26H33N2/c1-16-12-17(2)18(3)23(13-16)25-22-9-8-20(21-10-11-26(5,6)15-21)14-24(22)27-19(4)28(25)7/h8-9,12-14,21H,10-11,15H2,1-7H3/q+1 |
| InChIKey | SGHDSJDRIVWQCG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|