C33H38N+ — CID 169055566
6-(3,3-dimethylcyclopentyl)-2-methyl-8-(4-methylphenyl)-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium (PubChem CID 169055566) has the molecular formula C33H38N+ and a molecular weight of 448.67 g/mol. Its IUPAC name is 6-(3,3-dimethylcyclopentyl)-2-methyl-8-(4-methylphenyl)-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium.
| Compound Name | 6-(3,3-dimethylcyclopentyl)-2-methyl-8-(4-methylphenyl)-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 169055566 |
| Molecular Formula | C33H38N+ |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 6-(3,3-dimethylcyclopentyl)-2-methyl-8-(4-methylphenyl)-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
| SMILES | Cc1ccc(-c2cc(C3CCC(C)(C)C3)cc3cc(-c4cc(C)cc(C)c4C)[n+](C)cc23)cc1 |
| InChI | InChI=1S/C33H38N/c1-21-8-10-25(11-9-21)30-17-27(26-12-13-33(5,6)19-26)16-28-18-32(34(7)20-31(28)30)29-15-22(2)14-23(3)24(29)4/h8-11,14-18,20,26H,12-13,19H2,1-7H3/q+1 |
| InChIKey | PXBRSFCNOVRLNJ-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|