C16H25NO2S — CID 64640842
2-(2,4-dimethylphenyl)sulfonyl-4,4-dimethylcyclohexan-1-amine (PubChem CID 64640842) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfonyl-4,4-dimethylcyclohexan-1-amine.
| Compound Name | 2-(2,4-dimethylphenyl)sulfonyl-4,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64640842 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfonyl-4,4-dimethylcyclohexan-1-amine |
| SMILES | Cc1ccc(S(=O)(=O)C2CC(C)(C)CCC2N)c(C)c1 |
| InChI | InChI=1S/C16H25NO2S/c1-11-5-6-14(12(2)9-11)20(18,19)15-10-16(3,4)8-7-13(15)17/h5-6,9,13,15H,7-8,10,17H2,1-4H3 |
| InChIKey | HHHJNCJAUMJNTE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |