C14H20O3S — CID 106585470
3-(2,4-dimethylphenyl)sulfonyl-2-methylcyclopentan-1-ol (PubChem CID 106585470) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)sulfonyl-2-methylcyclopentan-1-ol.
| Compound Name | 3-(2,4-dimethylphenyl)sulfonyl-2-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 106585470 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-(2,4-dimethylphenyl)sulfonyl-2-methylcyclopentan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)C2CCC(O)C2C)c(C)c1 |
| InChI | InChI=1S/C14H20O3S/c1-9-4-6-13(10(2)8-9)18(16,17)14-7-5-12(15)11(14)3/h4,6,8,11-12,14-15H,5,7H2,1-3H3 |
| InChIKey | AAAFUVBTJKLAHV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |