C24H28N+ — CID 176592510
3-(5-cyclopentyl-2,3-dimethylphenyl)-2,6-dimethylisoquinolin-2-ium (PubChem CID 176592510) has the molecular formula C24H28N+ and a molecular weight of 330.50 g/mol. Its IUPAC name is 3-(5-cyclopentyl-2,3-dimethylphenyl)-2,6-dimethylisoquinolin-2-ium.
| Compound Name | 3-(5-cyclopentyl-2,3-dimethylphenyl)-2,6-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 176592510 |
| Molecular Formula | C24H28N+ |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 3-(5-cyclopentyl-2,3-dimethylphenyl)-2,6-dimethylisoquinolin-2-ium |
| SMILES | Cc1ccc2c[n+](C)c(-c3cc(C4CCCC4)cc(C)c3C)cc2c1 |
| InChI | InChI=1S/C24H28N/c1-16-9-10-20-15-25(4)24(14-21(20)11-16)23-13-22(12-17(2)18(23)3)19-7-5-6-8-19/h9-15,19H,5-8H2,1-4H3/q+1 |
| InChIKey | RALYZZBULKXLPP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|