C26H29N2+ — CID 166501206
6-[(1-isocyanocyclopentyl)methyl]-2-methyl-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium (PubChem CID 166501206) has the molecular formula C26H29N2+ and a molecular weight of 369.53 g/mol. Its IUPAC name is 6-[(1-isocyanocyclopentyl)methyl]-2-methyl-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium.
| Compound Name | 6-[(1-isocyanocyclopentyl)methyl]-2-methyl-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 166501206 |
| Molecular Formula | C26H29N2+ |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 6-[(1-isocyanocyclopentyl)methyl]-2-methyl-3-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
| SMILES | [C-]#[N+]C1(Cc2ccc3c[n+](C)c(-c4cc(C)cc(C)c4C)cc3c2)CCCC1 |
| InChI | InChI=1S/C26H29N2/c1-18-12-19(2)20(3)24(13-18)25-15-23-14-21(8-9-22(23)17-28(25)5)16-26(27-4)10-6-7-11-26/h8-9,12-15,17H,6-7,10-11,16H2,1-3,5H3/q+1 |
| InChIKey | QWHBQFJKUVYNOK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|