C21H21N2+ — CID 158489946
11-methyl-12-(2,3,5-trimethylphenyl)-3-aza-11-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 158489946) has the molecular formula C21H21N2+ and a molecular weight of 301.41 g/mol. Its IUPAC name is 11-methyl-12-(2,3,5-trimethylphenyl)-3-aza-11-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 11-methyl-12-(2,3,5-trimethylphenyl)-3-aza-11-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 158489946 |
| Molecular Formula | C21H21N2+ |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 11-methyl-12-(2,3,5-trimethylphenyl)-3-aza-11-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | Cc1cc(C)c(C)c(-c2cc3c(c[n+]2C)Cc2cccnc2-3)c1 |
| InChI | InChI=1S/C21H21N2/c1-13-8-14(2)15(3)18(9-13)20-11-19-17(12-23(20)4)10-16-6-5-7-22-21(16)19/h5-9,11-12H,10H2,1-4H3/q+1 |
| InChIKey | YJORBUHMGSKTAI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|