C20H20N3+ — CID 157214923
5-methyl-6-(2,3,5-trimethylphenyl)-3,11-diaza-5-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 157214923) has the molecular formula C20H20N3+ and a molecular weight of 302.40 g/mol. Its IUPAC name is 5-methyl-6-(2,3,5-trimethylphenyl)-3,11-diaza-5-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-methyl-6-(2,3,5-trimethylphenyl)-3,11-diaza-5-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 157214923 |
| Molecular Formula | C20H20N3+ |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 5-methyl-6-(2,3,5-trimethylphenyl)-3,11-diaza-5-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1cc(C)c(C)c(-c2c3c(nc[n+]2C)-c2ccncc2C3)c1 |
| InChI | InChI=1S/C20H20N3/c1-12-7-13(2)14(3)17(8-12)20-18-9-15-10-21-6-5-16(15)19(18)22-11-23(20)4/h5-8,10-11H,9H2,1-4H3/q+1 |
| InChIKey | ZZSTZJZDALUGCV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|