C15H15N — CID 157341186
3,4,8-trimethyl-5H-indeno[1,2-b]pyridine (PubChem CID 157341186) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,4,8-trimethyl-5H-indeno[1,2-b]pyridine.
| Compound Name | 3,4,8-trimethyl-5H-indeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 157341186 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3,4,8-trimethyl-5H-indeno[1,2-b]pyridine |
| SMILES | Cc1ccc2c(c1)-c1ncc(C)c(C)c1C2 |
| InChI | InChI=1S/C15H15N/c1-9-4-5-12-7-13-11(3)10(2)8-16-15(13)14(12)6-9/h4-6,8H,7H2,1-3H3 |
| InChIKey | SPXOIESSWSSXAW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |