C14H13N — CID 118329788
3,6-dimethyl-9H-indeno[2,1-c]pyridine (PubChem CID 118329788) has the molecular formula C14H13N and a molecular weight of 195.26 g/mol. Its IUPAC name is 3,6-dimethyl-9H-indeno[2,1-c]pyridine.
| Compound Name | 3,6-dimethyl-9H-indeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 118329788 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3,6-dimethyl-9H-indeno[2,1-c]pyridine |
| SMILES | Cc1ccc2c(c1)-c1cc(C)ncc1C2 |
| InChI | InChI=1S/C14H13N/c1-9-3-4-11-7-12-8-15-10(2)6-14(12)13(11)5-9/h3-6,8H,7H2,1-2H3 |
| InChIKey | JBSTXTBYVFREQM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |