C14H11NO2 — CID 158252708
3-methyl-9H-indeno[2,1-c]pyridine-7-carboxylic acid (PubChem CID 158252708) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-methyl-9H-indeno[2,1-c]pyridine-7-carboxylic acid.
| Compound Name | 3-methyl-9H-indeno[2,1-c]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 158252708 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-methyl-9H-indeno[2,1-c]pyridine-7-carboxylic acid |
| SMILES | Cc1cc2c(cn1)Cc1cc(C(=O)O)ccc1-2 |
| InChI | InChI=1S/C14H11NO2/c1-8-4-13-11(7-15-8)6-10-5-9(14(16)17)2-3-12(10)13/h2-5,7H,6H2,1H3,(H,16,17) |
| InChIKey | GEHCTOHXQXLXIS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |