C30H18O6 — CID 101463764
heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3(8),4,6,10,12(17),13,15,19,21(26),22,24-dodecaene-6,15,24-tricarboxylic acid (PubChem CID 101463764) has the molecular formula C30H18O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3(8),4,6,10,12(17),13,15,19,21(26),22,24-dodecaene-6,15,24-tricarboxylic acid.
| Compound Name | heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3(8),4,6,10,12(17),13,15,19,21(26),22,24-dodecaene-6,15,24-tricarboxylic acid |
|---|---|
| PubChem CID | 101463764 |
| Molecular Formula | C30H18O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3(8),4,6,10,12(17),13,15,19,21(26),22,24-dodecaene-6,15,24-tricarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)Cc1c-2c2c(c3c1-c1ccc(C(=O)O)cc1C3)-c1ccc(C(=O)O)cc1C2 |
| InChI | InChI=1S/C30H18O6/c31-28(32)13-1-4-19-16(7-13)10-22-25(19)23-11-17-8-14(29(33)34)2-5-20(17)27(23)24-12-18-9-15(30(35)36)3-6-21(18)26(22)24/h1-9H,10-12H2,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | GAJLZJGYHQDCGG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |