C10H9NO3 — CID 135742200
3-oxo-2,4-dihydro-1H-isoquinoline-6-carboxylic acid (PubChem CID 135742200) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-oxo-2,4-dihydro-1H-isoquinoline-6-carboxylic acid.
| Compound Name | 3-oxo-2,4-dihydro-1H-isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 135742200 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3-oxo-2,4-dihydro-1H-isoquinoline-6-carboxylic acid |
| SMILES | O=C1Cc2cc(C(=O)O)ccc2CN1 |
| InChI | InChI=1S/C10H9NO3/c12-9-4-8-3-6(10(13)14)1-2-7(8)5-11-9/h1-3H,4-5H2,(H,11,12)(H,13,14) |
| InChIKey | XEWPMORYHHWESK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |