C13H14ClNO2 — CID 10264190
7-(3-chloropropanoyl)-1,2,3,5-tetrahydro-3-benzazepin-4-one (PubChem CID 10264190) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 7-(3-chloropropanoyl)-1,2,3,5-tetrahydro-3-benzazepin-4-one.
| Compound Name | 7-(3-chloropropanoyl)-1,2,3,5-tetrahydro-3-benzazepin-4-one |
|---|---|
| PubChem CID | 10264190 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 7-(3-chloropropanoyl)-1,2,3,5-tetrahydro-3-benzazepin-4-one |
| SMILES | O=C1Cc2cc(C(=O)CCCl)ccc2CCN1 |
| InChI | InChI=1S/C13H14ClNO2/c14-5-3-12(16)10-2-1-9-4-6-15-13(17)8-11(9)7-10/h1-2,7H,3-6,8H2,(H,15,17) |
| InChIKey | SPBVOELTLXJSJI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|