C16H20N2O2 — CID 65366624
4-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-1,4-diazepan-2-one (PubChem CID 65366624) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366624 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-[2-(2,3-dihydro-1H-inden-5-yl)-2-oxoethyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(CC(=O)c2ccc3c(c2)CCC3)CCCN1 |
| InChI | InChI=1S/C16H20N2O2/c19-15(10-18-8-2-7-17-16(20)11-18)14-6-5-12-3-1-4-13(12)9-14/h5-6,9H,1-4,7-8,10-11H2,(H,17,20) |
| InChIKey | HOJJUTNRJZMLTN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |