C13H15ClN2O3 — CID 60680385
4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]piperazin-2-one (PubChem CID 60680385) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]piperazin-2-one.
| Compound Name | 4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 60680385 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl]piperazin-2-one |
| SMILES | COc1ccc(C(=O)CN2CCNC(=O)C2)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O3/c1-19-12-3-2-9(6-10(12)14)11(17)7-16-5-4-15-13(18)8-16/h2-3,6H,4-5,7-8H2,1H3,(H,15,18) |
| InChIKey | SYQBWDRSWBQEBR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |