C14H17FN2O3 — CID 65366237
4-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-1,4-diazepan-2-one (PubChem CID 65366237) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366237 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-1,4-diazepan-2-one |
| SMILES | COc1ccc(F)cc1C(=O)CN1CCCNC(=O)C1 |
| InChI | InChI=1S/C14H17FN2O3/c1-20-13-4-3-10(15)7-11(13)12(18)8-17-6-2-5-16-14(19)9-17/h3-4,7H,2,5-6,8-9H2,1H3,(H,16,19) |
| InChIKey | HHOXKAWHWSKRBN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |