C13H14F2N2O2 — CID 65366677
4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,4-diazepan-2-one (PubChem CID 65366677) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,4-diazepan-2-one.
| Compound Name | 4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366677 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(CC(=O)c2ccc(F)cc2F)CCCN1 |
| InChI | InChI=1S/C13H14F2N2O2/c14-9-2-3-10(11(15)6-9)12(18)7-17-5-1-4-16-13(19)8-17/h2-3,6H,1,4-5,7-8H2,(H,16,19) |
| InChIKey | LZSUAJRGBRDLCS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |