1-chloro-9H-fluorene-2,7-dicarboxylic acid

C15H9ClO4 — CID 57032951

IUPAC1-chloro-9H-fluorene-2,7-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)Cc1c-2ccc(C(=O)O)c1Cl
InChIInChI=1S/C15H9ClO4/c16-13-11(15(19)20)4-3-10-9-2-1-7(14(17)18)5-8(9)6-12(10)13/h1-5H,6H2,(H,17,18)(H,19,20)
InChIKeyFTLQRBJAUYCVEG-UHFFFAOYSA-N
MW288.69 g/mol
LogP3.31
Rot. Bonds2

About 1-chloro-9H-fluorene-2,7-dicarboxylic acid

1-chloro-9H-fluorene-2,7-dicarboxylic acid (PubChem CID 57032951) has the molecular formula C15H9ClO4 and a molecular weight of 288.69 g/mol. Its IUPAC name is 1-chloro-9H-fluorene-2,7-dicarboxylic acid.

Molecular Properties

Compound Name1-chloro-9H-fluorene-2,7-dicarboxylic acid
PubChem CID57032951
Molecular FormulaC15H9ClO4
Molecular Weight288.69 g/mol
Exact Mass288.02
IUPAC Name1-chloro-9H-fluorene-2,7-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)Cc1c-2ccc(C(=O)O)c1Cl
InChIInChI=1S/C15H9ClO4/c16-13-11(15(19)20)4-3-10-9-2-1-7(14(17)18)5-8(9)6-12(10)13/h1-5H,6H2,(H,17,18)(H,19,20)
InChIKeyFTLQRBJAUYCVEG-UHFFFAOYSA-N
XLogP3.31
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.69
LogP ≤ 53.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-chloro-9H-fluorene-2,7-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-9H-fluorene-2,7-dicarboxylic acid?
The IUPAC name of 1-chloro-9H-fluorene-2,7-dicarboxylic acid (CID 57032951) is 1-chloro-9H-fluorene-2,7-dicarboxylic acid.
What is the SMILES notation for 1-chloro-9H-fluorene-2,7-dicarboxylic acid?
The canonical SMILES for 1-chloro-9H-fluorene-2,7-dicarboxylic acid is O=C(O)c1ccc2c(c1)Cc1c-2ccc(C(=O)O)c1Cl.
What is the InChIKey of 1-chloro-9H-fluorene-2,7-dicarboxylic acid?
The InChIKey is FTLQRBJAUYCVEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClO4/c16-13-11(15(19)20)4-3-10-9-2-1-7(14(17)18)5-8(9)6-12(10)13/h1-5H,6H2,(H,17,18)(H,19,20).
What are the key properties of 1-chloro-9H-fluorene-2,7-dicarboxylic acid?
1-chloro-9H-fluorene-2,7-dicarboxylic acid has a molecular weight of 288.69 g/mol, XLogP of 3.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-9H-fluorene-2,7-dicarboxylic acid is sourced from PubChem (CID 57032951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).