C25H29N4+ — CID 158549485
3-methyl-6-[5-(2-methylpropyl)pyrazin-2-yl]-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium (PubChem CID 158549485) has the molecular formula C25H29N4+ and a molecular weight of 385.54 g/mol. Its IUPAC name is 3-methyl-6-[5-(2-methylpropyl)pyrazin-2-yl]-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium.
| Compound Name | 3-methyl-6-[5-(2-methylpropyl)pyrazin-2-yl]-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 158549485 |
| Molecular Formula | C25H29N4+ |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-methyl-6-[5-(2-methylpropyl)pyrazin-2-yl]-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3c(nc[n+]2C)C=C(c2cnc(CC(C)C)cn2)C3)c1 |
| InChI | InChI=1S/C25H29N4/c1-15(2)7-20-12-27-24(13-26-20)19-10-22-23(11-19)28-14-29(6)25(22)21-9-16(3)8-17(4)18(21)5/h8-9,11-15H,7,10H2,1-6H3/q+1 |
| InChIKey | MQYOUGCJUHLGNQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|