C26H31N4+ — CID 158606850
7-[5-(2,2-dimethylpropyl)pyrazin-2-yl]-3-methyl-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium (PubChem CID 158606850) has the molecular formula C26H31N4+ and a molecular weight of 399.56 g/mol. Its IUPAC name is 7-[5-(2,2-dimethylpropyl)pyrazin-2-yl]-3-methyl-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium.
| Compound Name | 7-[5-(2,2-dimethylpropyl)pyrazin-2-yl]-3-methyl-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 158606850 |
| Molecular Formula | C26H31N4+ |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 7-[5-(2,2-dimethylpropyl)pyrazin-2-yl]-3-methyl-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3c(nc[n+]2C)C(c2cnc(CC(C)(C)C)cn2)=CC3)c1 |
| InChI | InChI=1S/C26H31N4/c1-16-10-17(2)18(3)22(11-16)25-21-9-8-20(24(21)29-15-30(25)7)23-14-27-19(13-28-23)12-26(4,5)6/h8,10-11,13-15H,9,12H2,1-7H3/q+1 |
| InChIKey | OKTMMCHUSHIXTC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|