C20H20N5+ — CID 161128615
3-methyl-7-(1,3,5-triazin-2-yl)-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium (PubChem CID 161128615) has the molecular formula C20H20N5+ and a molecular weight of 330.42 g/mol. Its IUPAC name is 3-methyl-7-(1,3,5-triazin-2-yl)-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium.
| Compound Name | 3-methyl-7-(1,3,5-triazin-2-yl)-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 161128615 |
| Molecular Formula | C20H20N5+ |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-methyl-7-(1,3,5-triazin-2-yl)-4-(2,3,5-trimethylphenyl)-5H-cyclopenta[d]pyrimidin-3-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3c(nc[n+]2C)C(c2ncncn2)=CC3)c1 |
| InChI | InChI=1S/C20H20N5/c1-12-7-13(2)14(3)17(8-12)19-15-5-6-16(18(15)24-11-25(19)4)20-22-9-21-10-23-20/h6-11H,5H2,1-4H3/q+1 |
| InChIKey | QQXWWQYMAFEEHK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|