C30H29N2+ — CID 160811505
6,8,15-trimethyl-5-(2,3,5-trimethylphenyl)-7-aza-6-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene (PubChem CID 160811505) has the molecular formula C30H29N2+ and a molecular weight of 417.58 g/mol. Its IUPAC name is 6,8,15-trimethyl-5-(2,3,5-trimethylphenyl)-7-aza-6-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene.
| Compound Name | 6,8,15-trimethyl-5-(2,3,5-trimethylphenyl)-7-aza-6-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 160811505 |
| Molecular Formula | C30H29N2+ |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 6,8,15-trimethyl-5-(2,3,5-trimethylphenyl)-7-aza-6-azoniapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4,6,8,11,14,16,18-nonaene |
| SMILES | Cc1cc(C)c(C)c(-c2c3c(c(C)n[n+]2C)-c2ccc4c(c2C3)Cc2cccc(C)c2-4)c1 |
| InChI | InChI=1S/C30H29N2/c1-16-12-18(3)19(4)24(13-16)30-27-15-26-23(29(27)20(5)31-32(30)6)11-10-22-25(26)14-21-9-7-8-17(2)28(21)22/h7-13H,14-15H2,1-6H3/q+1 |
| InChIKey | ZWUGJNTUKUFNNT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|