C22H23N2+ — CID 157469544
3,5-dimethyl-2-(2,3,5-trimethylphenyl)-9H-indeno[2,1-d]pyrimidin-3-ium (PubChem CID 157469544) has the molecular formula C22H23N2+ and a molecular weight of 315.44 g/mol. Its IUPAC name is 3,5-dimethyl-2-(2,3,5-trimethylphenyl)-9H-indeno[2,1-d]pyrimidin-3-ium.
| Compound Name | 3,5-dimethyl-2-(2,3,5-trimethylphenyl)-9H-indeno[2,1-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 157469544 |
| Molecular Formula | C22H23N2+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3,5-dimethyl-2-(2,3,5-trimethylphenyl)-9H-indeno[2,1-d]pyrimidin-3-ium |
| SMILES | Cc1cc(C)c(C)c(-c2nc3c(c[n+]2C)-c2c(C)cccc2C3)c1 |
| InChI | InChI=1S/C22H23N2/c1-13-9-15(3)16(4)18(10-13)22-23-20-11-17-8-6-7-14(2)21(17)19(20)12-24(22)5/h6-10,12H,11H2,1-5H3/q+1 |
| InChIKey | DKQPQYIBGCIZOG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|