C19H18N3+ — CID 159935272
4,11-dimethyl-5-(2-methylphenyl)-6,10-diaza-4-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 159935272) has the molecular formula C19H18N3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is 4,11-dimethyl-5-(2-methylphenyl)-6,10-diaza-4-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4,11-dimethyl-5-(2-methylphenyl)-6,10-diaza-4-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 159935272 |
| Molecular Formula | C19H18N3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4,11-dimethyl-5-(2-methylphenyl)-6,10-diaza-4-azoniatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | Cc1ccc2c(n1)Cc1nc(-c3ccccc3C)[n+](C)cc1-2 |
| InChI | InChI=1S/C19H18N3/c1-12-6-4-5-7-14(12)19-21-18-10-17-15(9-8-13(2)20-17)16(18)11-22(19)3/h4-9,11H,10H2,1-3H3/q+1 |
| InChIKey | XNCFXQRSZXDJSB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|