C22H20N3+ — CID 158512896
5,13-dimethyl-4-(2-methylphenyl)-4,12-diaza-5-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,5,7,11(16),12,14-heptaene (PubChem CID 158512896) has the molecular formula C22H20N3+ and a molecular weight of 326.42 g/mol. Its IUPAC name is 5,13-dimethyl-4-(2-methylphenyl)-4,12-diaza-5-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,5,7,11(16),12,14-heptaene.
| Compound Name | 5,13-dimethyl-4-(2-methylphenyl)-4,12-diaza-5-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,5,7,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 158512896 |
| Molecular Formula | C22H20N3+ |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5,13-dimethyl-4-(2-methylphenyl)-4,12-diaza-5-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,5,7,11(16),12,14-heptaene |
| SMILES | Cc1ccc2c(n1)Cc1ccc3c(cn(-c4ccccc4C)[n+]3C)c1-2 |
| InChI | InChI=1S/C22H20N3/c1-14-6-4-5-7-20(14)25-13-18-21(24(25)3)11-9-16-12-19-17(22(16)18)10-8-15(2)23-19/h4-11,13H,12H2,1-3H3/q+1 |
| InChIKey | OJPXXLLOVVNINT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|