C34H36N3+ — CID 158505388
12-[2,6-di(propan-2-yl)phenyl]-5,14-dimethyl-13-(2-methylphenyl)-6,12-diaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15),13-heptaene (PubChem CID 158505388) has the molecular formula C34H36N3+ and a molecular weight of 486.68 g/mol. Its IUPAC name is 12-[2,6-di(propan-2-yl)phenyl]-5,14-dimethyl-13-(2-methylphenyl)-6,12-diaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15),13-heptaene.
| Compound Name | 12-[2,6-di(propan-2-yl)phenyl]-5,14-dimethyl-13-(2-methylphenyl)-6,12-diaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15),13-heptaene |
|---|---|
| PubChem CID | 158505388 |
| Molecular Formula | C34H36N3+ |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 12-[2,6-di(propan-2-yl)phenyl]-5,14-dimethyl-13-(2-methylphenyl)-6,12-diaza-14-azoniatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15),13-heptaene |
| SMILES | Cc1ccc2c(n1)Cc1cc3c(cc1-2)[n+](C)c(-c1ccccc1C)n3-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C34H36N3/c1-20(2)25-13-10-14-26(21(3)4)33(25)37-32-18-24-17-30-28(16-15-23(6)35-30)29(24)19-31(32)36(7)34(37)27-12-9-8-11-22(27)5/h8-16,18-21H,17H2,1-7H3/q+1 |
| InChIKey | WRKRKXBLMUEPKW-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|