C27H32N3+ — CID 123135867
1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-5-(2-methylphenyl)imidazo[4,5-b]pyridin-4-ium (PubChem CID 123135867) has the molecular formula C27H32N3+ and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-5-(2-methylphenyl)imidazo[4,5-b]pyridin-4-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-5-(2-methylphenyl)imidazo[4,5-b]pyridin-4-ium |
|---|---|
| PubChem CID | 123135867 |
| Molecular Formula | C27H32N3+ |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2,4-dimethyl-5-(2-methylphenyl)imidazo[4,5-b]pyridin-4-ium |
| SMILES | Cc1ccccc1-c1ccc2c(nc(C)n2-c2c(C(C)C)cccc2C(C)C)[n+]1C |
| InChI | InChI=1S/C27H32N3/c1-17(2)21-13-10-14-22(18(3)4)26(21)30-20(6)28-27-25(30)16-15-24(29(27)7)23-12-9-8-11-19(23)5/h8-18H,1-7H3/q+1 |
| InChIKey | CRFJKFGYXLMZMR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|