C20H23N2+ — CID 123928150
1-methyl-2-(2-methylphenyl)-7-(2-methylpropyl)-1,8-naphthyridin-1-ium (PubChem CID 123928150) has the molecular formula C20H23N2+ and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenyl)-7-(2-methylpropyl)-1,8-naphthyridin-1-ium.
| Compound Name | 1-methyl-2-(2-methylphenyl)-7-(2-methylpropyl)-1,8-naphthyridin-1-ium |
|---|---|
| PubChem CID | 123928150 |
| Molecular Formula | C20H23N2+ |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-methyl-2-(2-methylphenyl)-7-(2-methylpropyl)-1,8-naphthyridin-1-ium |
| SMILES | Cc1ccccc1-c1ccc2ccc(CC(C)C)nc2[n+]1C |
| InChI | InChI=1S/C20H23N2/c1-14(2)13-17-11-9-16-10-12-19(22(4)20(16)21-17)18-8-6-5-7-15(18)3/h5-12,14H,13H2,1-4H3/q+1 |
| InChIKey | WCYVJBDXVYWFGB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|