C22H25N2+ — CID 123166684
1-methyl-2-(2-methylphenyl)-4-[6-(2-methylpropyl)-2-pyridinyl]pyridin-1-ium (PubChem CID 123166684) has the molecular formula C22H25N2+ and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenyl)-4-[6-(2-methylpropyl)-2-pyridinyl]pyridin-1-ium.
| Compound Name | 1-methyl-2-(2-methylphenyl)-4-[6-(2-methylpropyl)-2-pyridinyl]pyridin-1-ium |
|---|---|
| PubChem CID | 123166684 |
| Molecular Formula | C22H25N2+ |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 1-methyl-2-(2-methylphenyl)-4-[6-(2-methylpropyl)-2-pyridinyl]pyridin-1-ium |
| SMILES | Cc1ccccc1-c1cc(-c2cccc(CC(C)C)n2)cc[n+]1C |
| InChI | InChI=1S/C22H25N2/c1-16(2)14-19-9-7-11-21(23-19)18-12-13-24(4)22(15-18)20-10-6-5-8-17(20)3/h5-13,15-16H,14H2,1-4H3/q+1 |
| InChIKey | ZFNVKFNFDSQENW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|