C35H38N3+ — CID 123143746
8-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5,5,7-trimethylindeno[1,2-c]pyridine (PubChem CID 123143746) has the molecular formula C35H38N3+ and a molecular weight of 500.71 g/mol. Its IUPAC name is 8-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5,5,7-trimethylindeno[1,2-c]pyridine.
| Compound Name | 8-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5,5,7-trimethylindeno[1,2-c]pyridine |
|---|---|
| PubChem CID | 123143746 |
| Molecular Formula | C35H38N3+ |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 8-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5,5,7-trimethylindeno[1,2-c]pyridine |
| SMILES | Cc1cc2c(cc1-c1n(-c3c(C(C)C)cccc3C(C)C)c3ccccc3[n+]1C)-c1cnccc1C2(C)C |
| InChI | InChI=1S/C35H38N3/c1-21(2)24-12-11-13-25(22(3)4)33(24)38-32-15-10-9-14-31(32)37(8)34(38)26-19-27-28-20-36-17-16-29(28)35(6,7)30(27)18-23(26)5/h9-22H,1-8H3/q+1 |
| InChIKey | FEBWNFNWWUGCQG-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|