C37H43N2+ — CID 158993057
2-(5-tert-butyl-2-methylphenyl)-3-[2,6-di(propan-2-yl)phenyl]-1-methyl-5-phenylbenzimidazol-1-ium (PubChem CID 158993057) has the molecular formula C37H43N2+ and a molecular weight of 515.77 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-methylphenyl)-3-[2,6-di(propan-2-yl)phenyl]-1-methyl-5-phenylbenzimidazol-1-ium.
| Compound Name | 2-(5-tert-butyl-2-methylphenyl)-3-[2,6-di(propan-2-yl)phenyl]-1-methyl-5-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 158993057 |
| Molecular Formula | C37H43N2+ |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | 2-(5-tert-butyl-2-methylphenyl)-3-[2,6-di(propan-2-yl)phenyl]-1-methyl-5-phenylbenzimidazol-1-ium |
| SMILES | Cc1ccc(C(C)(C)C)cc1-c1n(-c2c(C(C)C)cccc2C(C)C)c2cc(-c3ccccc3)ccc2[n+]1C |
| InChI | InChI=1S/C37H43N2/c1-24(2)30-16-13-17-31(25(3)4)35(30)39-34-22-28(27-14-11-10-12-15-27)19-21-33(34)38(9)36(39)32-23-29(37(6,7)8)20-18-26(32)5/h10-25H,1-9H3/q+1 |
| InChIKey | GNEBUBCDISGBBM-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|