C25H25N2+ — CID 158994181
2-methyl-1-(2-methylphenyl)-3-[3-methyl-5-(trideuteriomethyl)phenyl]-4-phenylpyrazol-2-ium (PubChem CID 158994181) has the molecular formula C25H25N2+ and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-methyl-1-(2-methylphenyl)-3-[3-methyl-5-(trideuteriomethyl)phenyl]-4-phenylpyrazol-2-ium.
| Compound Name | 2-methyl-1-(2-methylphenyl)-3-[3-methyl-5-(trideuteriomethyl)phenyl]-4-phenylpyrazol-2-ium |
|---|---|
| PubChem CID | 158994181 |
| Molecular Formula | C25H25N2+ |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-methyl-1-(2-methylphenyl)-3-[3-methyl-5-(trideuteriomethyl)phenyl]-4-phenylpyrazol-2-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)cc(-c2c(-c3ccccc3)cn(-c3ccccc3C)[n+]2C)c1 |
| InChI | InChI=1S/C25H25N2/c1-18-14-19(2)16-22(15-18)25-23(21-11-6-5-7-12-21)17-27(26(25)4)24-13-9-8-10-20(24)3/h5-17H,1-4H3/q+1/i1D3 |
| InChIKey | TZPNFOADJGAGCH-FIBGUPNXSA-N |
| XLogP | 5.56 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|