C31H35N2+ — CID 159338560
2-(3,5-dimethylphenyl)-1,5,9-trimethyl-3-phenyl-4,4,5-tris(trideuteriomethyl)pyrazolo[1,5-a]quinolin-1-ium (PubChem CID 159338560) has the molecular formula C31H35N2+ and a molecular weight of 444.69 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1,5,9-trimethyl-3-phenyl-4,4,5-tris(trideuteriomethyl)pyrazolo[1,5-a]quinolin-1-ium.
| Compound Name | 2-(3,5-dimethylphenyl)-1,5,9-trimethyl-3-phenyl-4,4,5-tris(trideuteriomethyl)pyrazolo[1,5-a]quinolin-1-ium |
|---|---|
| PubChem CID | 159338560 |
| Molecular Formula | C31H35N2+ |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1,5,9-trimethyl-3-phenyl-4,4,5-tris(trideuteriomethyl)pyrazolo[1,5-a]quinolin-1-ium |
| SMILES | [2H]C([2H])([2H])C1(C)c2cccc(C)c2-n2c(c(-c3ccccc3)c(-c3cc(C)cc(C)c3)[n+]2C)C1(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H35N2/c1-20-17-21(2)19-24(18-20)28-26(23-14-10-9-11-15-23)29-31(6,7)30(4,5)25-16-12-13-22(3)27(25)33(29)32(28)8/h9-19H,1-8H3/q+1/i4D3,6D3,7D3 |
| InChIKey | ANYKYEXEZLKRJI-UYVZNCSISA-N |
| XLogP | 7.13 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|