C26H33N2+ — CID 157063109
2-(3,5-dimethylphenyl)-4-ethyl-1,4,5,5,9-pentamethylpyrazolo[1,5-a]quinolin-1-ium (PubChem CID 157063109) has the molecular formula C26H33N2+ and a molecular weight of 373.56 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-4-ethyl-1,4,5,5,9-pentamethylpyrazolo[1,5-a]quinolin-1-ium.
| Compound Name | 2-(3,5-dimethylphenyl)-4-ethyl-1,4,5,5,9-pentamethylpyrazolo[1,5-a]quinolin-1-ium |
|---|---|
| PubChem CID | 157063109 |
| Molecular Formula | C26H33N2+ |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4-ethyl-1,4,5,5,9-pentamethylpyrazolo[1,5-a]quinolin-1-ium |
| SMILES | CCC1(C)c2cc(-c3cc(C)cc(C)c3)[n+](C)n2-c2c(C)cccc2C1(C)C |
| InChI | InChI=1S/C26H33N2/c1-9-26(7)23-16-22(20-14-17(2)13-18(3)15-20)27(8)28(23)24-19(4)11-10-12-21(24)25(26,5)6/h10-16H,9H2,1-8H3/q+1 |
| InChIKey | SLDMOKHELFBCJX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|