C17H18 — CID 145360802
9-ethyl-4,9-dimethylfluorene (PubChem CID 145360802) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is 9-ethyl-4,9-dimethylfluorene.
| Compound Name | 9-ethyl-4,9-dimethylfluorene |
|---|---|
| PubChem CID | 145360802 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 9-ethyl-4,9-dimethylfluorene |
| SMILES | CCC1(C)c2ccccc2-c2c(C)cccc21 |
| InChI | InChI=1S/C17H18/c1-4-17(3)14-10-6-5-9-13(14)16-12(2)8-7-11-15(16)17/h5-11H,4H2,1-3H3 |
| InChIKey | CGXREAIKUOSPFG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |