C37H42 — CID 145360801
(4E)-4-ethenyl-2-methylhexa-1,4-diene;9-ethyl-4,9-dimethylfluorene;2-methylnaphthalene (PubChem CID 145360801) has the molecular formula C37H42 and a molecular weight of 486.74 g/mol. Its IUPAC name is (4E)-4-ethenyl-2-methylhexa-1,4-diene;9-ethyl-4,9-dimethylfluorene;2-methylnaphthalene.
| Compound Name | (4E)-4-ethenyl-2-methylhexa-1,4-diene;9-ethyl-4,9-dimethylfluorene;2-methylnaphthalene |
|---|---|
| PubChem CID | 145360801 |
| Molecular Formula | C37H42 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (4E)-4-ethenyl-2-methylhexa-1,4-diene;9-ethyl-4,9-dimethylfluorene;2-methylnaphthalene |
| SMILES | C=C/C(=C/C)CC(=C)C.CCC1(C)c2ccccc2-c2c(C)cccc21.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18.C11H10.C9H14/c1-4-17(3)14-10-6-5-9-13(14)16-12(2)8-7-11-15(16)17;1-9-6-7-10-4-2-3-5-11(10)8-9;1-5-9(6-2)7-8(3)4/h5-11H,4H2,1-3H3;2-8H,1H3;5-6H,1,3,7H2,2,4H3/b;;9-6- |
| InChIKey | XSSZJASURNDWLA-QLCRIWHZSA-N |
| XLogP | 10.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|