C24H27N — CID 164734136
1,4,4,5,5,9-hexamethyl-3-phenylpyrrolo[1,2-a]quinoline (PubChem CID 164734136) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is 1,4,4,5,5,9-hexamethyl-3-phenylpyrrolo[1,2-a]quinoline.
| Compound Name | 1,4,4,5,5,9-hexamethyl-3-phenylpyrrolo[1,2-a]quinoline |
|---|---|
| PubChem CID | 164734136 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1,4,4,5,5,9-hexamethyl-3-phenylpyrrolo[1,2-a]quinoline |
| SMILES | Cc1cccc2c1-n1c(C)cc(-c3ccccc3)c1C(C)(C)C2(C)C |
| InChI | InChI=1S/C24H27N/c1-16-11-10-14-20-21(16)25-17(2)15-19(18-12-8-7-9-13-18)22(25)24(5,6)23(20,3)4/h7-15H,1-6H3 |
| InChIKey | XRXOMHUKMIMUNC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|