C33H39N2+ — CID 123981776
1-[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123981776) has the molecular formula C33H39N2+ and a molecular weight of 463.69 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 1-[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123981776 |
| Molecular Formula | C33H39N2+ |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | 1-[4-(3,5-dimethylphenyl)-2,6-dimethylphenyl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCC1(C)c2ccccc2-c2n(-c3c(C)cc(-c4cc(C)cc(C)c4)cc3C)cc[n+]2C1(C)CC |
| InChI | InChI=1S/C33H39N2/c1-9-32(7)29-14-12-11-13-28(29)31-34(15-16-35(31)33(32,8)10-2)30-24(5)20-27(21-25(30)6)26-18-22(3)17-23(4)19-26/h11-21H,9-10H2,1-8H3/q+1 |
| InChIKey | WEBSTBLPQRWUKN-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|