C28H35N2+ — CID 123858598
1-[2,6-di(propan-2-yl)phenyl]-5,5-diethylimidazo[2,1-a][2]benzazepin-4-ium (PubChem CID 123858598) has the molecular formula C28H35N2+ and a molecular weight of 399.60 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-5,5-diethylimidazo[2,1-a][2]benzazepin-4-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-5,5-diethylimidazo[2,1-a][2]benzazepin-4-ium |
|---|---|
| PubChem CID | 123858598 |
| Molecular Formula | C28H35N2+ |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-5,5-diethylimidazo[2,1-a][2]benzazepin-4-ium |
| SMILES | CCC1(CC)C=Cc2ccccc2-c2n(-c3c(C(C)C)cccc3C(C)C)cc[n+]21 |
| InChI | InChI=1S/C28H35N2/c1-7-28(8-2)17-16-22-12-9-10-13-25(22)27-29(18-19-30(27)28)26-23(20(3)4)14-11-15-24(26)21(5)6/h9-21H,7-8H2,1-6H3/q+1 |
| InChIKey | XIYXLNUROYXPNP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|