C31H43N2+ — CID 123301544
5,5-diethyl-1-[2,4,6-tri(propan-2-yl)phenyl]-6,7-dihydroimidazo[2,1-a][2]benzazepin-4-ium (PubChem CID 123301544) has the molecular formula C31H43N2+ and a molecular weight of 443.70 g/mol. Its IUPAC name is 5,5-diethyl-1-[2,4,6-tri(propan-2-yl)phenyl]-6,7-dihydroimidazo[2,1-a][2]benzazepin-4-ium.
| Compound Name | 5,5-diethyl-1-[2,4,6-tri(propan-2-yl)phenyl]-6,7-dihydroimidazo[2,1-a][2]benzazepin-4-ium |
|---|---|
| PubChem CID | 123301544 |
| Molecular Formula | C31H43N2+ |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | 5,5-diethyl-1-[2,4,6-tri(propan-2-yl)phenyl]-6,7-dihydroimidazo[2,1-a][2]benzazepin-4-ium |
| SMILES | CCC1(CC)CCc2ccccc2-c2n(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)cc[n+]21 |
| InChI | InChI=1S/C31H43N2/c1-9-31(10-2)16-15-24-13-11-12-14-26(24)30-32(17-18-33(30)31)29-27(22(5)6)19-25(21(3)4)20-28(29)23(7)8/h11-14,17-23H,9-10,15-16H2,1-8H3/q+1 |
| InChIKey | LPMFTAARLCCHFL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|