C26H31N2+ — CID 123631508
5,5-diethyl-12-methyl-17-propan-2-yl-1-aza-4-azoniapentacyclo[9.7.2.04,19.07,20.013,18]icosa-2,4(19),7(20),8,10,13(18),14,16-octaene (PubChem CID 123631508) has the molecular formula C26H31N2+ and a molecular weight of 371.55 g/mol. Its IUPAC name is 5,5-diethyl-12-methyl-17-propan-2-yl-1-aza-4-azoniapentacyclo[9.7.2.04,19.07,20.013,18]icosa-2,4(19),7(20),8,10,13(18),14,16-octaene.
| Compound Name | 5,5-diethyl-12-methyl-17-propan-2-yl-1-aza-4-azoniapentacyclo[9.7.2.04,19.07,20.013,18]icosa-2,4(19),7(20),8,10,13(18),14,16-octaene |
|---|---|
| PubChem CID | 123631508 |
| Molecular Formula | C26H31N2+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 5,5-diethyl-12-methyl-17-propan-2-yl-1-aza-4-azoniapentacyclo[9.7.2.04,19.07,20.013,18]icosa-2,4(19),7(20),8,10,13(18),14,16-octaene |
| SMILES | CCC1(CC)Cc2cccc3c2-c2n(cc[n+]21)-c1c(C(C)C)cccc1C3C |
| InChI | InChI=1S/C26H31N2/c1-6-26(7-2)16-19-10-8-12-21-18(5)22-13-9-11-20(17(3)4)24(22)27-14-15-28(26)25(27)23(19)21/h8-15,17-18H,6-7,16H2,1-5H3/q+1 |
| InChIKey | QPIITQGEEQOVTP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|