C28H37N2+ — CID 123927657
1-[2,6-di(propan-2-yl)phenyl]-5,5-diethyl-6-methyl-6H-imidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123927657) has the molecular formula C28H37N2+ and a molecular weight of 401.62 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-5,5-diethyl-6-methyl-6H-imidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-5,5-diethyl-6-methyl-6H-imidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123927657 |
| Molecular Formula | C28H37N2+ |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-5,5-diethyl-6-methyl-6H-imidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCC1(CC)C(C)c2ccccc2-c2n(-c3c(C(C)C)cccc3C(C)C)cc[n+]21 |
| InChI | InChI=1S/C28H37N2/c1-8-28(9-2)21(7)24-13-10-11-14-25(24)27-29(17-18-30(27)28)26-22(19(3)4)15-12-16-23(26)20(5)6/h10-21H,8-9H2,1-7H3/q+1 |
| InChIKey | VURPIPSSPBZKJU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|