C33H47N2+ — CID 123633687
5,6-diethyl-1-(2-heptan-2-yl-6-propan-2-ylphenyl)-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123633687) has the molecular formula C33H47N2+ and a molecular weight of 471.75 g/mol. Its IUPAC name is 5,6-diethyl-1-(2-heptan-2-yl-6-propan-2-ylphenyl)-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 5,6-diethyl-1-(2-heptan-2-yl-6-propan-2-ylphenyl)-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123633687 |
| Molecular Formula | C33H47N2+ |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 471.37 |
| IUPAC Name | 5,6-diethyl-1-(2-heptan-2-yl-6-propan-2-ylphenyl)-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCCCCC(C)c1cccc(C(C)C)c1-n1cc[n+]2c1-c1ccccc1C(C)(CC)C2(C)CC |
| InChI | InChI=1S/C33H47N2/c1-9-12-13-17-25(6)27-20-16-19-26(24(4)5)30(27)34-22-23-35-31(34)28-18-14-15-21-29(28)32(7,10-2)33(35,8)11-3/h14-16,18-25H,9-13,17H2,1-8H3/q+1 |
| InChIKey | OCIWCWRKXKWLGW-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|