C37H49N2+ — CID 91806819
5,6-diethyl-12-(2-heptan-2-yl-7,7-dimethylcyclohepta-1,3,5-trien-1-yl)-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium (PubChem CID 91806819) has the molecular formula C37H49N2+ and a molecular weight of 521.81 g/mol. Its IUPAC name is 5,6-diethyl-12-(2-heptan-2-yl-7,7-dimethylcyclohepta-1,3,5-trien-1-yl)-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium.
| Compound Name | 5,6-diethyl-12-(2-heptan-2-yl-7,7-dimethylcyclohepta-1,3,5-trien-1-yl)-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 91806819 |
| Molecular Formula | C37H49N2+ |
| Molecular Weight | 521.81 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | 5,6-diethyl-12-(2-heptan-2-yl-7,7-dimethylcyclohepta-1,3,5-trien-1-yl)-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
| SMILES | CCCCCC(C)C1=C(n2c3[n+](c4ccccc42)C(C)(CC)C(C)(CC)c2ccccc2-3)C(C)(C)C=CC=C1 |
| InChI | InChI=1S/C37H49N2/c1-9-12-13-20-27(4)28-21-18-19-26-35(5,6)33(28)38-31-24-16-17-25-32(31)39-34(38)29-22-14-15-23-30(29)36(7,10-2)37(39,8)11-3/h14-19,21-27H,9-13,20H2,1-8H3/q+1 |
| InChIKey | XUKZLBOTIAWVAZ-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.81 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|