C49H59N2S+ — CID 123521946
12-[4-(4-butylcyclohexyl)-2-cyclohexyldibenzothiophen-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium (PubChem CID 123521946) has the molecular formula C49H59N2S+ and a molecular weight of 708.09 g/mol. Its IUPAC name is 12-[4-(4-butylcyclohexyl)-2-cyclohexyldibenzothiophen-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium.
| Compound Name | 12-[4-(4-butylcyclohexyl)-2-cyclohexyldibenzothiophen-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
|---|---|
| PubChem CID | 123521946 |
| Molecular Formula | C49H59N2S+ |
| Molecular Weight | 708.09 g/mol |
| Exact Mass | 707.44 |
| IUPAC Name | 12-[4-(4-butylcyclohexyl)-2-cyclohexyldibenzothiophen-1-yl]-5,6-diethyl-5,6-dimethylbenzimidazolo[2,1-a]isoquinolin-7-ium |
| SMILES | CCCCC1CCC(c2cc(C3CCCCC3)c(-n3c4[n+](c5ccccc53)C(C)(CC)C(C)(CC)c3ccccc3-4)c3c2sc2ccccc23)CC1 |
| InChI | InChI=1S/C49H59N2S/c1-6-9-19-33-28-30-35(31-29-33)39-32-38(34-20-11-10-12-21-34)45(44-37-23-14-18-27-43(37)52-46(39)44)50-41-25-16-17-26-42(41)51-47(50)36-22-13-15-24-40(36)48(4,7-2)49(51,5)8-3/h13-18,22-27,32-35H,6-12,19-21,28-31H2,1-5H3/q+1 |
| InChIKey | ABBVIBCAAGEMMW-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.09 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|