C34H49N2+ — CID 123680402
7-butyl-20,21-diethyl-5,5,8,8,12,20,21-heptamethyl-1-aza-12-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),3,9,12,14,16,18-heptaene (PubChem CID 123680402) has the molecular formula C34H49N2+ and a molecular weight of 485.78 g/mol. Its IUPAC name is 7-butyl-20,21-diethyl-5,5,8,8,12,20,21-heptamethyl-1-aza-12-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),3,9,12,14,16,18-heptaene.
| Compound Name | 7-butyl-20,21-diethyl-5,5,8,8,12,20,21-heptamethyl-1-aza-12-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),3,9,12,14,16,18-heptaene |
|---|---|
| PubChem CID | 123680402 |
| Molecular Formula | C34H49N2+ |
| Molecular Weight | 485.78 g/mol |
| Exact Mass | 485.39 |
| IUPAC Name | 7-butyl-20,21-diethyl-5,5,8,8,12,20,21-heptamethyl-1-aza-12-azoniapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-2(11),3,9,12,14,16,18-heptaene |
| SMILES | CCCCC1CC(C)(C)c2cc3c(cc2C1(C)C)[n+](C)c1n3C(C)(CC)C(C)(CC)c2ccccc2-1 |
| InChI | InChI=1S/C34H49N2/c1-11-14-17-23-22-31(4,5)26-20-29-28(21-27(26)32(23,6)7)35(10)30-24-18-15-16-19-25(24)33(8,12-2)34(9,13-3)36(29)30/h15-16,18-21,23H,11-14,17,22H2,1-10H3/q+1 |
| InChIKey | ATFYUNFGFDFYDA-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.78 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|