C19H24N+ — CID 123201333
8,9-diethyl-8,14-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene (PubChem CID 123201333) has the molecular formula C19H24N+ and a molecular weight of 266.41 g/mol. Its IUPAC name is 8,9-diethyl-8,14-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene.
| Compound Name | 8,9-diethyl-8,14-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 123201333 |
| Molecular Formula | C19H24N+ |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 8,9-diethyl-8,14-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
| SMILES | CCC1c2cccc([n+]2C)-c2ccccc2C1(C)CC |
| InChI | InChI=1S/C19H24N/c1-5-15-18-13-9-12-17(20(18)4)14-10-7-8-11-16(14)19(15,3)6-2/h7-13,15H,5-6H2,1-4H3/q+1 |
| InChIKey | DMOMEABLNXJSNM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|