C17H16N+ — CID 148702041
1,15-dimethyl-14-methylidene-13-azoniatetracyclo[10.2.1.02,7.08,13]pentadeca-2,4,6,8(13),9,11-hexaene (PubChem CID 148702041) has the molecular formula C17H16N+ and a molecular weight of 234.32 g/mol. Its IUPAC name is 1,15-dimethyl-14-methylidene-13-azoniatetracyclo[10.2.1.02,7.08,13]pentadeca-2,4,6,8(13),9,11-hexaene.
| Compound Name | 1,15-dimethyl-14-methylidene-13-azoniatetracyclo[10.2.1.02,7.08,13]pentadeca-2,4,6,8(13),9,11-hexaene |
|---|---|
| PubChem CID | 148702041 |
| Molecular Formula | C17H16N+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1,15-dimethyl-14-methylidene-13-azoniatetracyclo[10.2.1.02,7.08,13]pentadeca-2,4,6,8(13),9,11-hexaene |
| SMILES | C=C1[n+]2c3cccc2C(C)C1(C)c1ccccc1-3 |
| InChI | InChI=1S/C17H16N/c1-11-15-9-6-10-16-13-7-4-5-8-14(13)17(11,3)12(2)18(15)16/h4-11H,2H2,1,3H3/q+1 |
| InChIKey | AZUSLKHISPMBTG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|