C15H12O — CID 101107078
(3'R)-3'-methylspiro[fluorene-9,2'-oxirane] (PubChem CID 101107078) has the molecular formula C15H12O and a molecular weight of 208.26 g/mol. Its IUPAC name is (3'R)-3'-methylspiro[fluorene-9,2'-oxirane].
| Compound Name | (3'R)-3'-methylspiro[fluorene-9,2'-oxirane] |
|---|---|
| PubChem CID | 101107078 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (3'R)-3'-methylspiro[fluorene-9,2'-oxirane] |
| SMILES | C[C@H]1OC12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C15H12O/c1-10-15(16-10)13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10H,1H3/t10-/m1/s1 |
| InChIKey | YCAAMNKSIQEVKU-SNVBAGLBSA-N |
| XLogP | 3.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|